Nomenclature of Organic Compounds

TL;DR

Nomenclature gives organic compounds unique names based on their structure, following IUPAC rules. You identify the longest carbon chain, functional groups, and substituents to build a systematic name. This structured naming allows chemists worldwide to understand exactly which molecule is being discussed.

1. The Mental Model

Think of organic nomenclature as building a name from a set of Lego blocks: you have specific pieces (functional groups, carbon chains) and rules for how to snap them together (placement, numbering) to create a unique identifier for each molecular structure.

2. The Core Material

Nomenclature of organic compounds uses a systematic approach, primarily governed by the International Union of Pure and Applied Chemistry (IUPAC) rules. This system ensures every unique organic molecule has a unique name, and every unique name corresponds to one molecule.

Let's break down the key components of an organic name:

Root Name: The Carbon Backbone

The root name tells you the number of carbons in the longest continuous chain (the "parent chain").
* 1 carbon: meth-
* 2 carbons: eth-
* 3 carbons: prop-
* 4 carbons: but-
* 5 carbons: pent-
* 6 carbons: hex-
* 7 carbons: hept-
* 8 carbons: oct-
* 9 carbons: non-
* 10 carbons: dec-

Suffix: Functional Groups and Saturation

The suffix indicates the presence of a functional group and the degree of saturation (single, double, or triple bonds).

• Alkanes: Only single C-C bonds. Suffix: -ane. (e.g., methane, ethane)
• Alkenes: Contain at least one C=C double bond. Suffix: -ene. (e.g., ethene, propene)
• Alkynes: Contain at least one C≡C triple bond. Suffix: -yne. (e.g., ethyne, propyne)
• Alcohols: Contain an -OH group. Suffix: -ol. (e.g., ethanol)
• Aldehydes: Contain an -CHO group. Suffix: -al. (e.g., ethanal)
• Ketones: Contain a C=O group within the chain. Suffix: -one. (e.g., propanone)
• Carboxylic Acids: Contain a -COOH group. Suffix: -oic acid. (e.g., ethanoic acid)
• Esters: Contain a -COO- group. Suffix: -oate. (e.g., methyl ethanoate)

When multiple functional groups are present, one is chosen as the principal functional group (highest priority) and gets the suffix. Others are named as prefixes.

Prefixes: Substituents

Prefixes describe any other groups (substituents) attached to the parent chain, like alkyl groups (methyl, ethyl) or halogen atoms (chloro, bromo).

• Alkyl groups:
  • -CH3: methyl
  • -CH2CH3: ethyl
  • -CH2CH2CH3: propyl
• Halogens:
  • -F: fluoro
  • -Cl: chloro
  • -Br: bromo
  • -I: iodo
• Other common prefixes:
  • -NO2: nitro
  • -NH2 (as a substituent): amino
  • -OR (alkoxy): methoxy, ethoxy

Numbering the Chain

You number the parent chain to give the principal functional group the lowest possible number. If there are no functional groups, number to give substituents the lowest numbers. If there's a tie, prioritize alphabetical order for substituents.

Putting It All Together: The Naming Process

Here's a general flowchart for naming:

graph TD
    A["Identify the longest continuous carbon chain (Parent Chain)"] --> B["Determine the number of carbons in the parent chain (Root)"]
    B --> C["Identify the principal functional group(s) (Suffix)"]
    C --> D["Number the parent chain (Lowest number for principal functional group)"]
    D --> E["Identify all substituents (Prefixes)"]
    E --> F["Assign numbers to each substituent"]
    F --> G["Assemble the name alphabetically:
        (Substituent #s)-(Substituent Prefixes)-(Root)-(Saturation/Functional Suffix)"]
    G --> H["Final IUPAC Name"]

Example: Naming an Alkane

Let's name this:
CH3-CH(CH3)-CH2-CH3

1. Longest Chain: The longest continuous chain is 4 carbons long (butane).
2. Functional Group: Only single bonds (alkane). Suffix: -ane.
3. Substituents: There's a -CH3 group attached. This is a methyl group.
4. Numbering: If we number from left, the methyl is on carbon 2. If we number from right, it's on carbon 3. We choose the lower number: 2.
5. Assemble: 2-methylbutane.

Example: Naming an Alcohol

Let's name this:
CH3-CH2-CH(OH)-CH3

1. Longest Chain: 4 carbons (but-).
2. Functional Group: -OH group (alcohol). Suffix: -ol.
3. Numbering: The -OH group is on carbon 2 if numbered from left, or carbon 3 if numbered from right. We choose 2.
4. Assemble: Butan-2-ol. (Note the number before the -ol to specify its position).

3. Worked Example

Let's name the following compound:

CH3-CH(CH3)-CH2-C(=O)-CH2-CH3

1. Identify the longest continuous carbon chain that includes the principal functional group.

   • We have a ketone (C=O) in the middle.
   • Starting from the left, we can count 1-2-3-4-5-6 carbons.
   • This makes our root "hex-".

2. Identify the principal functional group and determine the suffix.

   • The C=O group within the chain is a ketone.
   • The suffix for a ketone is "-one".

3. Number the parent chain to give the principal functional group the lowest possible number.

   • If we number from the left: C=O is on carbon 4.
   • CH3-CH(CH3)-CH2-C(=O)-CH2-CH3
     1 2 3 4 5 6
   • If we number from the right: C=O is on carbon 3.
   • CH3-CH2-C(=O)-CH2-CH(CH3)-CH3
     6 5 4 3 2 1
   • So, we number from the right, making the ketone on carbon 3. The parent chain is hexan-3-one.

4. Identify any substituents and their positions.

   • We have a -CH3 group attached to carbon 2 (when numbered from the right).
   • This is a "methyl" group.

5. Assemble the full name, combining prefixes, root, and suffix alphabetically.

   • Substituent: 2-methyl
   • Parent chain with functional group: hexan-3-one
   • Combining them: 2-methylhexan-3-one

4. Key Takeaways

• Every organic compound has a unique IUPAC name, and every IUPAC name corresponds to a unique compound.
• The parent chain is the longest continuous carbon chain, which might not always be straight.
• Functional groups determine the compound's class and are indicated by the suffix (e.g., -ol for alcohol, -one for ketone).
• Substituents (like alkyl groups or halogens) are named as prefixes before the parent chain.
• Numbering the carbon chain starts from the end that gives the principal functional group the lowest possible number.
• If multiple identical substituents are present, use di-, tri-, tetra- prefixes (e.g., 2,2-dimethyl).
• The full name is assembled alphabetically, ignoring prefixes like di-, tri-, sec-, tert-.

Common Mistakes to Avoid:
- Not finding the longest continuous carbon chain for the parent.
- Incorrectly identifying the principal functional group when multiple are present.
- Not giving the principal functional group the lowest possible number.
- Misnumbering the chain from the wrong end.
- Forgetting to specify the position of functional groups or substituents with numbers.

5. Now Try It

Draw the structure for 2,2,4-trimethylpentane. Then, name the following compound:
CH3-CH2-CH2-CH(CH3)-CH(CH3)-CH2-OH

What to do:
1. For 2,2,4-trimethylpentane, start by drawing the "pentane" backbone. Then, add the methyl groups at the specified positions.
2. For the unknown compound, follow the 5-step process from the "Worked Example" section. Identify the longest chain containing the -OH group, determine the suffix, number the chain correctly, identify substituents, and then assemble the name.

What success looks like:
For the first task, you should have a 5-carbon chain with three methyl groups: two on the second carbon and one on the fourth carbon. For the second task, you should arrive at the correct IUPAC name, carefully considering the numbering and placement of substituents.